C21H32N4O — CID 164690545
(1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164690545) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164690545 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-methylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | Cc1ccc(N2C[C@H]3C[C@@H](C2)[C@H](CCC(C)C)N2C(=O)CCC[C@@H]32)nn1 |
| InChI | InChI=1S/C21H32N4O/c1-14(2)7-9-19-17-11-16(18-5-4-6-21(26)25(18)19)12-24(13-17)20-10-8-15(3)22-23-20/h8,10,14,16-19H,4-7,9,11-13H2,1-3H3/t16-,17+,18+,19+/m1/s1 |
| InChIKey | HGOPVCDEXWMCAR-XWSJACJDSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |