C25H37N3O2 — CID 164690580
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methoxy-2-pyridinyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164690580) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methoxy-2-pyridinyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methoxy-2-pyridinyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164690580 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methoxy-2-pyridinyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COc1cccnc1CN1C[C@H]2C[C@@H](C1)[C@H](CC1CCCCC1)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C25H37N3O2/c1-30-24-10-6-12-26-21(24)17-27-15-19-14-20(16-27)23(13-18-7-3-2-4-8-18)28-22(19)9-5-11-25(28)29/h6,10,12,18-20,22-23H,2-5,7-9,11,13-17H2,1H3/t19-,20+,22+,23+/m1/s1 |
| InChIKey | VZWBQQABTYFYOE-VAPSRWTKSA-N |
| XLogP | 4.26 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |