C17H19N7O2 — CID 164692366
[(5S)-3-(methoxymethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 164692366) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is [(5S)-3-(methoxymethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [(5S)-3-(methoxymethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 164692366 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [(5S)-3-(methoxymethyl)-5-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | COCc1nnc2n1[C@@H](C)CN(C(=O)c1ccccc1-n1cncn1)C2 |
| InChI | InChI=1S/C17H19N7O2/c1-12-7-22(8-15-20-21-16(9-26-2)24(12)15)17(25)13-5-3-4-6-14(13)23-11-18-10-19-23/h3-6,10-12H,7-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | UXEGRBZFJIINMO-LBPRGKRZSA-N |
| XLogP | 1.22 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |