C24H35N3O2 — CID 164693209
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(6-oxo-1H-pyridin-3-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164693209) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(6-oxo-1H-pyridin-3-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(6-oxo-1H-pyridin-3-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164693209 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(6-oxo-1H-pyridin-3-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C1CCC[C@H]2[C@@H]3C[C@@H](CN(Cc4ccc(=O)[nH]c4)C3)[C@H](CC3CCCCC3)N12 |
| InChI | InChI=1S/C24H35N3O2/c28-23-10-9-18(13-25-23)14-26-15-19-12-20(16-26)22(11-17-5-2-1-3-6-17)27-21(19)7-4-8-24(27)29/h9-10,13,17,19-22H,1-8,11-12,14-16H2,(H,25,28)/t19-,20+,21+,22+/m1/s1 |
| InChIKey | OLXDFUWJXGMARN-MLNNCEHLSA-N |
| XLogP | 3.55 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |