C17H16N10O — CID 164693914
[(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone (PubChem CID 164693914) has the molecular formula C17H16N10O and a molecular weight of 376.38 g/mol. Its IUPAC name is [(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone.
| Compound Name | [(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone |
|---|---|
| PubChem CID | 164693914 |
| Molecular Formula | C17H16N10O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone |
| SMILES | C[C@H]1c2nc(-c3ccccc3)nn2CCN1C(=O)c1nc(-n2cnnc2)n[nH]1 |
| InChI | InChI=1S/C17H16N10O/c1-11-15-20-13(12-5-3-2-4-6-12)24-27(15)8-7-26(11)16(28)14-21-17(23-22-14)25-9-18-19-10-25/h2-6,9-11H,7-8H2,1H3,(H,21,22,23)/t11-/m0/s1 |
| InChIKey | RELCJFWTQHMKRL-NSHDSACASA-N |
| XLogP | 0.86 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |