About 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine
5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine (PubChem CID 164694367) has the molecular formula C14H21FN4O
and a molecular weight of 280.35 g/mol. Its IUPAC name is 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine |
| PubChem CID | 164694367 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine |
| SMILES | CO[C@@H]1CCC[C@]12CCCN(c1ncc(F)c(N)n1)C2 |
| InChI | InChI=1S/C14H21FN4O/c1-20-11-4-2-5-14(11)6-3-7-19(9-14)13-17-8-10(15)12(16)18-13/h8,11H,2-7,9H2,1H3,(H2,16,17,18)/t11-,14-/m1/s1 |
| InChIKey | UAWYOFNSDZMRCU-BXUZGUMPSA-N |
| XLogP | 1.98 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine?
The IUPAC name of 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine (CID 164694367) is 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine.
What is the SMILES notation for 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine?
The canonical SMILES for 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine is CO[C@@H]1CCC[C@]12CCCN(c1ncc(F)c(N)n1)C2.
What is the InChIKey of 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine?
The InChIKey is UAWYOFNSDZMRCU-BXUZGUMPSA-N. The full InChI is InChI=1S/C14H21FN4O/c1-20-11-4-2-5-14(11)6-3-7-19(9-14)13-17-8-10(15)12(16)18-13/h8,11H,2-7,9H2,1H3,(H2,16,17,18)/t11-,14-/m1/s1.
What are the key properties of 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine?
5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine has a molecular weight of 280.35 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decan-7-yl]pyrimidin-4-amine is sourced from PubChem (CID 164694367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).