C18H17N9O2 — CID 164694408
[7-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone (PubChem CID 164694408) has the molecular formula C18H17N9O2 and a molecular weight of 391.40 g/mol. Its IUPAC name is [7-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone.
| Compound Name | [7-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone |
|---|---|
| PubChem CID | 164694408 |
| Molecular Formula | C18H17N9O2 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [7-(3-methoxyphenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[3-(1,2,4-triazol-4-yl)-1H-1,2,4-triazol-5-yl]methanone |
| SMILES | COc1cccc(C2CN(C(=O)c3nc(-n4cnnc4)n[nH]3)Cc3[nH]cnc32)c1 |
| InChI | InChI=1S/C18H17N9O2/c1-29-12-4-2-3-11(5-12)13-6-26(7-14-15(13)20-8-19-14)17(28)16-23-18(25-24-16)27-9-21-22-10-27/h2-5,8-10,13H,6-7H2,1H3,(H,19,20)(H,23,24,25) |
| InChIKey | CEJLPRSNXRNLPP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |