C20H22N6O3 — CID 164694464
5-[2-[(5S)-5-methyl-3-(2-phenylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione (PubChem CID 164694464) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 5-[2-[(5S)-5-methyl-3-(2-phenylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[2-[(5S)-5-methyl-3-(2-phenylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164694464 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-[2-[(5S)-5-methyl-3-(2-phenylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
| SMILES | C[C@H]1CN(C(=O)Cc2c[nH]c(=O)[nH]c2=O)Cc2nnc(CCc3ccccc3)n21 |
| InChI | InChI=1S/C20H22N6O3/c1-13-11-25(18(27)9-15-10-21-20(29)22-19(15)28)12-17-24-23-16(26(13)17)8-7-14-5-3-2-4-6-14/h2-6,10,13H,7-9,11-12H2,1H3,(H2,21,22,28,29)/t13-/m0/s1 |
| InChIKey | DNCLIXXXHHCZLF-ZDUSSCGKSA-N |
| XLogP | 0.59 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |