C24H29NO3 — CID 164694763
1-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-4-phenoxybutan-1-one (PubChem CID 164694763) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 164694763 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-4-phenoxybutan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1[C@@H]2CC[C@H]1[C@](CO)(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H29NO3/c26-18-24(16-19-8-3-1-4-9-19)17-20-13-14-22(24)25(20)23(27)12-7-15-28-21-10-5-2-6-11-21/h1-6,8-11,20,22,26H,7,12-18H2/t20-,22+,24-/m1/s1 |
| InChIKey | OMAQYSDXEQYRGR-JCTONOIOSA-N |
| XLogP | 3.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|