C14H18F3NO2 — CID 164695096
(3R,5R)-1-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]piperidine-3,5-diol (PubChem CID 164695096) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is (3R,5R)-1-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]piperidine-3,5-diol.
| Compound Name | (3R,5R)-1-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]piperidine-3,5-diol |
|---|---|
| PubChem CID | 164695096 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (3R,5R)-1-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]piperidine-3,5-diol |
| SMILES | O[C@@H]1C[C@@H](O)CN(Cc2ccc(CC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H18F3NO2/c15-14(16,17)6-10-1-3-11(4-2-10)7-18-8-12(19)5-13(20)9-18/h1-4,12-13,19-20H,5-9H2/t12-,13-/m1/s1 |
| InChIKey | YZGXSWBJSZUTTD-CHWSQXEVSA-N |
| XLogP | 1.72 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |