C16H17N7O — CID 164695473
[(8R)-2-cyclopropyl-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone (PubChem CID 164695473) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is [(8R)-2-cyclopropyl-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone.
| Compound Name | [(8R)-2-cyclopropyl-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone |
|---|---|
| PubChem CID | 164695473 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [(8R)-2-cyclopropyl-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone |
| SMILES | C[C@@H]1c2nc(C3CC3)nn2CCN1C(=O)c1cccn2cnnc12 |
| InChI | InChI=1S/C16H17N7O/c1-10-14-18-13(11-4-5-11)20-23(14)8-7-22(10)16(24)12-3-2-6-21-9-17-19-15(12)21/h2-3,6,9-11H,4-5,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | WRZCXXUACAUUEK-SNVBAGLBSA-N |
| XLogP | 1.42 |
| TPSA | 81.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |