C26H34N4O — CID 164695504
(1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-phenylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164695504) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-phenylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-phenylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164695504 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(6-phenylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(c3ccc(-c4ccccc4)nn3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C26H34N4O/c1-18(2)11-13-24-21-15-20(23-9-6-10-26(31)30(23)24)16-29(17-21)25-14-12-22(27-28-25)19-7-4-3-5-8-19/h3-5,7-8,12,14,18,20-21,23-24H,6,9-11,13,15-17H2,1-2H3/t20-,21+,23+,24+/m1/s1 |
| InChIKey | LMPBLZCRBVULPC-KJBBBAAKSA-N |
| XLogP | 4.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |