C19H24N4O — CID 164695561
5-methyl-1-[(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]hex-4-en-1-one (PubChem CID 164695561) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 5-methyl-1-[(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]hex-4-en-1-one.
| Compound Name | 5-methyl-1-[(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]hex-4-en-1-one |
|---|---|
| PubChem CID | 164695561 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 5-methyl-1-[(8S)-8-methyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]hex-4-en-1-one |
| SMILES | CC(C)=CCCC(=O)N1CCn2nc(-c3ccccc3)nc2[C@@H]1C |
| InChI | InChI=1S/C19H24N4O/c1-14(2)8-7-11-17(24)22-12-13-23-19(15(22)3)20-18(21-23)16-9-5-4-6-10-16/h4-6,8-10,15H,7,11-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | QWBFANUWNZCXCW-HNNXBMFYSA-N |
| XLogP | 3.59 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|