C25H37N3O2 — CID 164695976
5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1-methylpyridin-2-one (PubChem CID 164695976) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 164695976 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CC2CCCCC2)N2CCCC[C@@H]32)ccc1=O |
| InChI | InChI=1S/C25H37N3O2/c1-26-15-19(10-11-24(26)29)25(30)27-16-20-14-21(17-27)23(13-18-7-3-2-4-8-18)28-12-6-5-9-22(20)28/h10-11,15,18,20-23H,2-9,12-14,16-17H2,1H3/t20-,21+,22+,23+/m1/s1 |
| InChIKey | BKQBZUVTIWKQTP-LDVJMBRRSA-N |
| XLogP | 3.67 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |