C25H32N4O — CID 164696022
(1R,2S,8S,9S)-8-benzyl-11-(6-propan-2-ylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164696022) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-benzyl-11-(6-propan-2-ylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-benzyl-11-(6-propan-2-ylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164696022 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (1R,2S,8S,9S)-8-benzyl-11-(6-propan-2-ylpyridazin-3-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)c1ccc(N2C[C@H]3C[C@@H](C2)[C@H](Cc2ccccc2)N2C(=O)CCC[C@@H]32)nn1 |
| InChI | InChI=1S/C25H32N4O/c1-17(2)21-11-12-24(27-26-21)28-15-19-14-20(16-28)23(13-18-7-4-3-5-8-18)29-22(19)9-6-10-25(29)30/h3-5,7-8,11-12,17,19-20,22-23H,6,9-10,13-16H2,1-2H3/t19-,20+,22+,23+/m1/s1 |
| InChIKey | XOAYTCREAPQNQU-VAPSRWTKSA-N |
| XLogP | 4.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |