About 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile
4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile (PubChem CID 164696073) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile |
| PubChem CID | 164696073 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile |
| SMILES | COc1nccc(N2CCC[C@]3(CCC[C@H]3O)C2)c1C#N |
| InChI | InChI=1S/C16H21N3O2/c1-21-15-12(10-17)13(5-8-18-15)19-9-3-7-16(11-19)6-2-4-14(16)20/h5,8,14,20H,2-4,6-7,9,11H2,1H3/t14-,16-/m1/s1 |
| InChIKey | OHBLEAPHJSBEIS-GDBMZVCRSA-N |
| XLogP | 2.09 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile?
The IUPAC name of 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile (CID 164696073) is 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile.
What is the SMILES notation for 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile?
The canonical SMILES for 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile is COc1nccc(N2CCC[C@]3(CCC[C@H]3O)C2)c1C#N.
What is the InChIKey of 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile?
The InChIKey is OHBLEAPHJSBEIS-GDBMZVCRSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-21-15-12(10-17)13(5-8-18-15)19-9-3-7-16(11-19)6-2-4-14(16)20/h5,8,14,20H,2-4,6-7,9,11H2,1H3/t14-,16-/m1/s1.
What are the key properties of 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile?
4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile has a molecular weight of 287.36 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-methoxypyridine-3-carbonitrile is sourced from PubChem (CID 164696073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).