C24H38N4O — CID 164696427
4-[[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 164696427) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is 4-[[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 164696427 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 4-[[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(CN2C[C@H]3C[C@@H](C2)[C@H](CC2CCCCC2)N2CCCC[C@@H]32)cc(=O)[nH]1 |
| InChI | InChI=1S/C24H38N4O/c1-17-25-21(13-24(29)26-17)16-27-14-19-12-20(15-27)23(11-18-7-3-2-4-8-18)28-10-6-5-9-22(19)28/h13,18-20,22-23H,2-12,14-16H2,1H3,(H,25,26,29)/t19-,20+,22+,23+/m1/s1 |
| InChIKey | LRVRYCPKIPNRAD-VAPSRWTKSA-N |
| XLogP | 3.72 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |