C18H24N4O3S2 — CID 164696475
4-(1-morpholin-4-ylsulfonyl-4-phenylpiperidin-4-yl)-1,3-thiazol-2-amine (PubChem CID 164696475) has the molecular formula C18H24N4O3S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-(1-morpholin-4-ylsulfonyl-4-phenylpiperidin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1-morpholin-4-ylsulfonyl-4-phenylpiperidin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 164696475 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-(1-morpholin-4-ylsulfonyl-4-phenylpiperidin-4-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C2(c3ccccc3)CCN(S(=O)(=O)N3CCOCC3)CC2)cs1 |
| InChI | InChI=1S/C18H24N4O3S2/c19-17-20-16(14-26-17)18(15-4-2-1-3-5-15)6-8-21(9-7-18)27(23,24)22-10-12-25-13-11-22/h1-5,14H,6-13H2,(H2,19,20) |
| InChIKey | WYSLSMDZMNFGSA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |