C17H24N2O2 — CID 164696726
1-[2-[(3S,4S)-3-hydroxy-4-phenylpiperidin-1-yl]ethyl]pyrrolidin-2-one (PubChem CID 164696726) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[2-[(3S,4S)-3-hydroxy-4-phenylpiperidin-1-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[(3S,4S)-3-hydroxy-4-phenylpiperidin-1-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 164696726 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[2-[(3S,4S)-3-hydroxy-4-phenylpiperidin-1-yl]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCN1CC[C@@H](c2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C17H24N2O2/c20-16-13-18(11-12-19-9-4-7-17(19)21)10-8-15(16)14-5-2-1-3-6-14/h1-3,5-6,15-16,20H,4,7-13H2/t15-,16+/m0/s1 |
| InChIKey | NZBSDYAUPSAZQP-JKSUJKDBSA-N |
| XLogP | 1.46 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |