C19H25N5O3 — CID 164696833
(6R,11R)-11-hydroxy-8-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,8-diazaspiro[5.5]undecan-1-one (PubChem CID 164696833) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (6R,11R)-11-hydroxy-8-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,8-diazaspiro[5.5]undecan-1-one.
| Compound Name | (6R,11R)-11-hydroxy-8-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,8-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 164696833 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (6R,11R)-11-hydroxy-8-(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)-2,8-diazaspiro[5.5]undecan-1-one |
| SMILES | Cc1cc(C(=O)N2CC[C@@H](O)[C@@]3(CCCNC3=O)C2)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C19H25N5O3/c1-11-9-13(15-12(2)22-23(3)16(15)21-11)17(26)24-8-5-14(25)19(10-24)6-4-7-20-18(19)27/h9,14,25H,4-8,10H2,1-3H3,(H,20,27)/t14-,19-/m1/s1 |
| InChIKey | RKBZVJREQXMERN-AUUYWEPGSA-N |
| XLogP | 0.69 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |