C21H32N4O3 — CID 164698620
6-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 164698620) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 6-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164698620 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 6-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(Cc3cc(=O)[nH]c(=O)[nH]3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C21H32N4O3/c1-13(2)6-7-18-15-8-14(17-4-3-5-20(27)25(17)18)10-24(11-15)12-16-9-19(26)23-21(28)22-16/h9,13-15,17-18H,3-8,10-12H2,1-2H3,(H2,22,23,26,28)/t14-,15+,17+,18+/m1/s1 |
| InChIKey | ZJBQEOWCOBLACF-FZCLSBEQSA-N |
| XLogP | 1.70 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |