C25H28N4O2 — CID 164698676
6-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-2-carbonitrile (PubChem CID 164698676) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 6-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-2-carbonitrile.
| Compound Name | 6-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 164698676 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 6-[(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-2-carbonitrile |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4cccc(C#N)n4)C3)[C@@H]3CCCC(=O)N32)c1 |
| InChI | InChI=1S/C25H28N4O2/c1-31-21-7-2-5-17(11-21)12-23-19-13-18(22-8-4-10-25(30)29(22)23)15-28(16-19)24-9-3-6-20(14-26)27-24/h2-3,5-7,9,11,18-19,22-23H,4,8,10,12-13,15-16H2,1H3/t18-,19+,22+,23+/m1/s1 |
| InChIKey | AJHBWCZQIWXUNX-FUKQBSRTSA-N |
| XLogP | 3.41 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |