C24H29N3O2 — CID 164698854
(1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164698854) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164698854 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (1R,2S,8S,9S)-8-[(3-methoxyphenyl)methyl]-11-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4ccccn4)C3)[C@@H]3CCCC(=O)N32)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-29-20-7-4-6-17(12-20)13-22-19-14-18(21-8-5-10-24(28)27(21)22)15-26(16-19)23-9-2-3-11-25-23/h2-4,6-7,9,11-12,18-19,21-22H,5,8,10,13-16H2,1H3/t18-,19+,21+,22+/m1/s1 |
| InChIKey | NTOZMTOMMGKOQV-WAGURGNTSA-N |
| XLogP | 3.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |