C21H26N6O2 — CID 164698862
[(6S,11S)-11-hydroxy-2,8-diazaspiro[5.5]undecan-2-yl]-[3-(1-methylpyrrol-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanone (PubChem CID 164698862) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is [(6S,11S)-11-hydroxy-2,8-diazaspiro[5.5]undecan-2-yl]-[3-(1-methylpyrrol-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanone.
| Compound Name | [(6S,11S)-11-hydroxy-2,8-diazaspiro[5.5]undecan-2-yl]-[3-(1-methylpyrrol-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 164698862 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(6S,11S)-11-hydroxy-2,8-diazaspiro[5.5]undecan-2-yl]-[3-(1-methylpyrrol-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanone |
| SMILES | Cn1cccc1-c1nnc2ccc(C(=O)N3CCC[C@]4(CNCC[C@@H]4O)C3)cn12 |
| InChI | InChI=1S/C21H26N6O2/c1-25-10-2-4-16(25)19-24-23-18-6-5-15(12-27(18)19)20(29)26-11-3-8-21(14-26)13-22-9-7-17(21)28/h2,4-6,10,12,17,22,28H,3,7-9,11,13-14H2,1H3/t17-,21-/m0/s1 |
| InChIKey | HJBHZNARJNBGKS-UWJYYQICSA-N |
| XLogP | 1.31 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |