About [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone
[(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone (PubChem CID 164699320) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone.
Molecular Properties
| Compound Name | [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone |
| PubChem CID | 164699320 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone |
| SMILES | CN1CCOC[C@H]1C(=O)N1CC2(COc3ccccc3C2)C1 |
| InChI | InChI=1S/C17H22N2O3/c1-18-6-7-21-9-14(18)16(20)19-10-17(11-19)8-13-4-2-3-5-15(13)22-12-17/h2-5,14H,6-12H2,1H3/t14-/m0/s1 |
| InChIKey | JQPXVJXTMWFHBR-AWEZNQCLSA-N |
| XLogP | 0.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone?
The IUPAC name of [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone (CID 164699320) is [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone.
What is the SMILES notation for [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone?
The canonical SMILES for [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone is CN1CCOC[C@H]1C(=O)N1CC2(COc3ccccc3C2)C1.
What is the InChIKey of [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone?
The InChIKey is JQPXVJXTMWFHBR-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-18-6-7-21-9-14(18)16(20)19-10-17(11-19)8-13-4-2-3-5-15(13)22-12-17/h2-5,14H,6-12H2,1H3/t14-/m0/s1.
What are the key properties of [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone?
[(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone has a molecular weight of 302.37 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-4-methylmorpholin-3-yl]-spiro[2,4-dihydrochromene-3,3'-azetidine]-1'-ylmethanone is sourced from PubChem (CID 164699320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).