C38H34Cl2FeP2 — CID 164702802
dibenzyl(cyclopenta-2,4-dien-1-yl)phosphane;dibenzyl-(2,3-dichlorocyclopenta-2,4-dien-1-yl)phosphane;iron(2+) (PubChem CID 164702802) has the molecular formula C38H34Cl2FeP2 and a molecular weight of 679.39 g/mol. Its IUPAC name is dibenzyl(cyclopenta-2,4-dien-1-yl)phosphane;dibenzyl-(2,3-dichlorocyclopenta-2,4-dien-1-yl)phosphane;iron(2+).
| Compound Name | dibenzyl(cyclopenta-2,4-dien-1-yl)phosphane;dibenzyl-(2,3-dichlorocyclopenta-2,4-dien-1-yl)phosphane;iron(2+) |
|---|---|
| PubChem CID | 164702802 |
| Molecular Formula | C38H34Cl2FeP2 |
| Molecular Weight | 679.39 g/mol |
| Exact Mass | 678.09 |
| IUPAC Name | dibenzyl(cyclopenta-2,4-dien-1-yl)phosphane;dibenzyl-(2,3-dichlorocyclopenta-2,4-dien-1-yl)phosphane;iron(2+) |
| SMILES | Clc1cc[c-](P(Cc2ccccc2)Cc2ccccc2)c1Cl.[Fe+2].c1ccc(CP(Cc2ccccc2)[c-]2cccc2)cc1 |
| InChI | InChI=1S/C19H16Cl2P.C19H18P.Fe/c20-17-11-12-18(19(17)21)22(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16;1-3-9-17(10-4-1)15-20(19-13-7-8-14-19)16-18-11-5-2-6-12-18;/h1-12H,13-14H2;1-14H,15-16H2;/q2*-1;+2 |
| InChIKey | DXMVLPFBWOWZJE-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.39 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|