C43H53IrN2O2S- — CID 164703165
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-deuterio-7-methyl-6-(2,4,6-trimethylphenyl)thieno[3,2-d]pyrimidine;(Z)-6-hydroxy-2,3,7,8-tetramethylnon-5-en-4-one;iridium (PubChem CID 164703165) has the molecular formula C43H53IrN2O2S- and a molecular weight of 855.20 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-deuterio-7-methyl-6-(2,4,6-trimethylphenyl)thieno[3,2-d]pyrimidine;(Z)-6-hydroxy-2,3,7,8-tetramethylnon-5-en-4-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-deuterio-7-methyl-6-(2,4,6-trimethylphenyl)thieno[3,2-d]pyrimidine;(Z)-6-hydroxy-2,3,7,8-tetramethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164703165 |
| Molecular Formula | C43H53IrN2O2S- |
| Molecular Weight | 855.20 g/mol |
| Exact Mass | 855.35 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-deuterio-7-methyl-6-(2,4,6-trimethylphenyl)thieno[3,2-d]pyrimidine;(Z)-6-hydroxy-2,3,7,8-tetramethylnon-5-en-4-one;iridium |
| SMILES | CC(C)C(C)C(=O)/C=C(\O)C(C)C(C)C.[2H]c1nc(-c2[c-]c3ccccc3c(C(C)(C)C)c2)c2sc(-c3c(C)cc(C)cc3C)c(C)c2n1.[Ir] |
| InChI | InChI=1S/C30H29N2S.C13H24O2.Ir/c1-17-12-18(2)25(19(3)13-17)28-20(4)26-29(33-28)27(32-16-31-26)22-14-21-10-8-9-11-23(21)24(15-22)30(5,6)7;1-8(2)10(5)12(14)7-13(15)11(6)9(3)4;/h8-13,15-16H,1-7H3;7-11,14H,1-6H3;/q-1;;/b;12-7-;/i16D;; |
| InChIKey | MIQDNFWLBKMHTC-ZVBSNCHOSA-N |
| XLogP | 12.09 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.20 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|