C40H45IrN2O2S- — CID 164703237
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-methyl-6-(4-phenylphenyl)thieno[3,2-d]pyrimidine;iridium (PubChem CID 164703237) has the molecular formula C40H45IrN2O2S- and a molecular weight of 810.10 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-methyl-6-(4-phenylphenyl)thieno[3,2-d]pyrimidine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-methyl-6-(4-phenylphenyl)thieno[3,2-d]pyrimidine;iridium |
|---|---|
| PubChem CID | 164703237 |
| Molecular Formula | C40H45IrN2O2S- |
| Molecular Weight | 810.10 g/mol |
| Exact Mass | 810.28 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-7-methyl-6-(4-phenylphenyl)thieno[3,2-d]pyrimidine;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2ncnc3c(C)c(-c4ccc(-c5ccccc5)cc4)sc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C27H21N2S.C13H24O2.Ir/c1-17-13-18(2)15-23(14-17)25-27-24(28-16-29-25)19(3)26(30-27)22-11-9-21(10-12-22)20-7-5-4-6-8-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-14,16H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | YJLOPQMSZQKFOK-DZTQYQPZSA-N |
| XLogP | 11.29 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.10 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|