C20H33ClFN5O2 — CID 164704901
(4-chloro-5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-(oxolan-3-ylmethylamino)-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]methanone (PubChem CID 164704901) has the molecular formula C20H33ClFN5O2 and a molecular weight of 429.97 g/mol. Its IUPAC name is (4-chloro-5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-(oxolan-3-ylmethylamino)-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]methanone.
| Compound Name | (4-chloro-5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-(oxolan-3-ylmethylamino)-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]methanone |
|---|---|
| PubChem CID | 164704901 |
| Molecular Formula | C20H33ClFN5O2 |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (4-chloro-5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-(oxolan-3-ylmethylamino)-2,3,3a,4,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrazin-5-yl]methanone |
| SMILES | O=C(C1CC2C(CCC(F)C2Cl)N1)N1CCN2NC(NCC3CCOC3)CC2C1 |
| InChI | InChI=1S/C20H33ClFN5O2/c21-19-14-8-17(24-16(14)2-1-15(19)22)20(28)26-4-5-27-13(10-26)7-18(25-27)23-9-12-3-6-29-11-12/h12-19,23-25H,1-11H2 |
| InChIKey | DCXGEJBJRUVQCA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|