C24H44F2O2Si — CID 164705730
(1R,3aR,7aR)-1-[(2R)-5,5-difluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 164705730) has the molecular formula C24H44F2O2Si and a molecular weight of 430.70 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(2R)-5,5-difluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[(2R)-5,5-difluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 164705730 |
| Molecular Formula | C24H44F2O2Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (1R,3aR,7aR)-1-[(2R)-5,5-difluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC[Si](CC)(CC)OC(C)(C)C(F)(F)CC[C@@H](C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C24H44F2O2Si/c1-8-29(9-2,10-3)28-22(5,6)24(25,26)17-15-18(4)19-13-14-20-21(27)12-11-16-23(19,20)7/h18-20H,8-17H2,1-7H3/t18-,19-,20+,23-/m1/s1 |
| InChIKey | HJTQDYPQLPFBHR-ISHFTEKXSA-N |
| XLogP | 7.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|