About carbanide;nitrocyclopentane;yttrium
carbanide;nitrocyclopentane;yttrium (PubChem CID 164705758) has the molecular formula C6H11NO2Y-2
and a molecular weight of 218.06 g/mol. Its IUPAC name is carbanide;nitrocyclopentane;yttrium.
Molecular Properties
| Compound Name | carbanide;nitrocyclopentane;yttrium |
| PubChem CID | 164705758 |
| Molecular Formula | C6H11NO2Y-2 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | carbanide;nitrocyclopentane;yttrium |
| SMILES | O=[N+]([O-])C1[CH-]CCC1.[CH3-].[Y] |
| InChI | InChI=1S/C5H8NO2.CH3.Y/c7-6(8)5-3-1-2-4-5;;/h3,5H,1-2,4H2;1H3;/q2*-1; |
| InChIKey | OJFXZGWLKYDZBV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;nitrocyclopentane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;nitrocyclopentane;yttrium?
The IUPAC name of carbanide;nitrocyclopentane;yttrium (CID 164705758) is carbanide;nitrocyclopentane;yttrium.
What is the SMILES notation for carbanide;nitrocyclopentane;yttrium?
The canonical SMILES for carbanide;nitrocyclopentane;yttrium is O=[N+]([O-])C1[CH-]CCC1.[CH3-].[Y].
What is the InChIKey of carbanide;nitrocyclopentane;yttrium?
The InChIKey is OJFXZGWLKYDZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8NO2.CH3.Y/c7-6(8)5-3-1-2-4-5;;/h3,5H,1-2,4H2;1H3;/q2*-1;.
What are the key properties of carbanide;nitrocyclopentane;yttrium?
carbanide;nitrocyclopentane;yttrium has a molecular weight of 218.06 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;nitrocyclopentane;yttrium is sourced from PubChem (CID 164705758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).