C40H31N11 — CID 164705905
5-methyl-10-[2,4,6-tris(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]phenazine (PubChem CID 164705905) has the molecular formula C40H31N11 and a molecular weight of 665.77 g/mol. Its IUPAC name is 5-methyl-10-[2,4,6-tris(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]phenazine.
| Compound Name | 5-methyl-10-[2,4,6-tris(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]phenazine |
|---|---|
| PubChem CID | 164705905 |
| Molecular Formula | C40H31N11 |
| Molecular Weight | 665.77 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | 5-methyl-10-[2,4,6-tris(3-methylimidazo[4,5-b]pyridin-2-yl)phenyl]phenazine |
| SMILES | CN1c2ccccc2N(c2c(-c3nc4cccnc4n3C)cc(-c3nc4cccnc4n3C)cc2-c2nc3cccnc3n2C)c2ccccc21 |
| InChI | InChI=1S/C40H31N11/c1-47-30-15-5-7-17-32(30)51(33-18-8-6-16-31(33)47)34-25(36-45-28-13-10-20-42-39(28)49(36)3)22-24(35-44-27-12-9-19-41-38(27)48(35)2)23-26(34)37-46-29-14-11-21-43-40(29)50(37)4/h5-23H,1-4H3 |
| InChIKey | LZUUBPHDDRCKDN-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 98.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.77 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |