About CID 164706126
CID 164706126 (PubChem CID 164706126) has the molecular formula C21H23N
and a molecular weight of 289.42 g/mol.
Molecular Properties
| Compound Name | CID 164706126 |
| PubChem CID | 164706126 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1C12[C]N(c3ccccc3)C(C)(CC1)CC2 |
| InChI | InChI=1S/C21H23N/c1-17-8-6-7-11-19(17)21-14-12-20(2,13-15-21)22(16-21)18-9-4-3-5-10-18/h3-11H,12-15H2,1-2H3 |
| InChIKey | JTGRHXDGMCEHFS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 164706126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164706126?
The IUPAC name of CID 164706126 (CID 164706126) is not available.
What is the SMILES notation for CID 164706126?
The canonical SMILES for CID 164706126 is Cc1ccccc1C12[C]N(c3ccccc3)C(C)(CC1)CC2.
What is the InChIKey of CID 164706126?
The InChIKey is JTGRHXDGMCEHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N/c1-17-8-6-7-11-19(17)21-14-12-20(2,13-15-21)22(16-21)18-9-4-3-5-10-18/h3-11H,12-15H2,1-2H3.
What are the key properties of CID 164706126?
CID 164706126 has a molecular weight of 289.42 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164706126 is sourced from PubChem (CID 164706126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).