C48H23N5O4 — CID 164707262
2-[bis(8,14-dioxo-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)amino]benzene-1,3-dicarbonitrile (PubChem CID 164707262) has the molecular formula C48H23N5O4 and a molecular weight of 733.74 g/mol. Its IUPAC name is 2-[bis(8,14-dioxo-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)amino]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[bis(8,14-dioxo-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)amino]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 164707262 |
| Molecular Formula | C48H23N5O4 |
| Molecular Weight | 733.74 g/mol |
| Exact Mass | 733.18 |
| IUPAC Name | 2-[bis(8,14-dioxo-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)amino]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1N(c1ccc2c(c1)c(=O)c1cccc3c(=O)c4ccccc4n2c31)c1ccc2c(c1)c(=O)c1cccc3c(=O)c4ccccc4n2c31 |
| InChI | InChI=1S/C48H23N5O4/c49-24-26-8-5-9-27(25-50)42(26)51(28-18-20-40-36(22-28)47(56)34-14-6-12-32-43(34)52(40)38-16-3-1-10-30(38)45(32)54)29-19-21-41-37(23-29)48(57)35-15-7-13-33-44(35)53(41)39-17-4-2-11-31(39)46(33)55/h1-23H |
| InChIKey | XPFRPSAVSWTLJK-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 127.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.74 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|