About 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium
4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium (PubChem CID 164708023) has the molecular formula C13H20NO4+
and a molecular weight of 254.31 g/mol. Its IUPAC name is 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium.
Molecular Properties
| Compound Name | 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium |
| PubChem CID | 164708023 |
| Molecular Formula | C13H20NO4+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium |
| SMILES | C[N+](C)(CCCCC(=O)O)c1cccc(O)c1O |
| InChI | InChI=1S/C13H19NO4/c1-14(2,9-4-3-8-12(16)17)10-6-5-7-11(15)13(10)18/h5-7H,3-4,8-9H2,1-2H3,(H2-,15,16,17,18)/p+1 |
| InChIKey | OIVNUEPOGZMNPO-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium?
The IUPAC name of 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium (CID 164708023) is 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium.
What is the SMILES notation for 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium?
The canonical SMILES for 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium is C[N+](C)(CCCCC(=O)O)c1cccc(O)c1O.
What is the InChIKey of 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium?
The InChIKey is OIVNUEPOGZMNPO-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H19NO4/c1-14(2,9-4-3-8-12(16)17)10-6-5-7-11(15)13(10)18/h5-7H,3-4,8-9H2,1-2H3,(H2-,15,16,17,18)/p+1.
What are the key properties of 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium?
4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium has a molecular weight of 254.31 g/mol, XLogP of 1.92, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carboxybutyl-(2,3-dihydroxyphenyl)-dimethylazanium is sourced from PubChem (CID 164708023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).