C12H9F4N3O2S — CID 164708130
6-fluoro-N-(1,2-thiazol-4-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carboxamide (PubChem CID 164708130) has the molecular formula C12H9F4N3O2S and a molecular weight of 335.28 g/mol. Its IUPAC name is 6-fluoro-N-(1,2-thiazol-4-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-(1,2-thiazol-4-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164708130 |
| Molecular Formula | C12H9F4N3O2S |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 6-fluoro-N-(1,2-thiazol-4-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyridine-3-carboxamide |
| SMILES | CC(Oc1nc(F)ccc1C(=O)Nc1cnsc1)C(F)(F)F |
| InChI | InChI=1S/C12H9F4N3O2S/c1-6(12(14,15)16)21-11-8(2-3-9(13)19-11)10(20)18-7-4-17-22-5-7/h2-6H,1H3,(H,18,20) |
| InChIKey | QQNSXRHHDLGRPD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|