C16H16FIN4O — CID 164708920
3-fluoro-4-[(4-iodo-1-piperidin-4-ylpyrazol-3-yl)oxymethyl]benzonitrile (PubChem CID 164708920) has the molecular formula C16H16FIN4O and a molecular weight of 426.23 g/mol. Its IUPAC name is 3-fluoro-4-[(4-iodo-1-piperidin-4-ylpyrazol-3-yl)oxymethyl]benzonitrile.
| Compound Name | 3-fluoro-4-[(4-iodo-1-piperidin-4-ylpyrazol-3-yl)oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 164708920 |
| Molecular Formula | C16H16FIN4O |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 3-fluoro-4-[(4-iodo-1-piperidin-4-ylpyrazol-3-yl)oxymethyl]benzonitrile |
| SMILES | N#Cc1ccc(COc2nn(C3CCNCC3)cc2I)c(F)c1 |
| InChI | InChI=1S/C16H16FIN4O/c17-14-7-11(8-19)1-2-12(14)10-23-16-15(18)9-22(21-16)13-3-5-20-6-4-13/h1-2,7,9,13,20H,3-6,10H2 |
| InChIKey | NMYLUJXANBDKMP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|