C25H21F2O4S+ — CID 164709217
tert-butyl 2-[2,6-difluoro-4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate (PubChem CID 164709217) has the molecular formula C25H21F2O4S+ and a molecular weight of 455.50 g/mol. Its IUPAC name is tert-butyl 2-[2,6-difluoro-4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[2,6-difluoro-4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 164709217 |
| Molecular Formula | C25H21F2O4S+ |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | tert-butyl 2-[2,6-difluoro-4-(9-oxothioxanthen-10-ium-10-yl)phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1c(F)cc(-[s+]2c3ccccc3c(=O)c3ccccc32)cc1F |
| InChI | InChI=1S/C25H21F2O4S/c1-25(2,3)31-22(28)14-30-24-18(26)12-15(13-19(24)27)32-20-10-6-4-8-16(20)23(29)17-9-5-7-11-21(17)32/h4-13H,14H2,1-3H3/q+1 |
| InChIKey | KRFKAZTWNKNFMP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|