About 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine
8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine (PubChem CID 164709359) has the molecular formula C24H21N3
and a molecular weight of 351.45 g/mol. Its IUPAC name is 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine.
Molecular Properties
| Compound Name | 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine |
| PubChem CID | 164709359 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine |
| SMILES | CC(C)(C)c1cc(-c2cc3c(ccc4nccn43)cn2)cc2ccccc12 |
| InChI | InChI=1S/C24H21N3/c1-24(2,3)20-13-18(12-16-6-4-5-7-19(16)20)21-14-22-17(15-26-21)8-9-23-25-10-11-27(22)23/h4-15H,1-3H3 |
| InChIKey | XJQIZXHUHCTLHQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine?
The IUPAC name of 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine (CID 164709359) is 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine.
What is the SMILES notation for 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine?
The canonical SMILES for 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine is CC(C)(C)c1cc(-c2cc3c(ccc4nccn43)cn2)cc2ccccc12.
What is the InChIKey of 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine?
The InChIKey is XJQIZXHUHCTLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3/c1-24(2,3)20-13-18(12-16-6-4-5-7-19(16)20)21-14-22-17(15-26-21)8-9-23-25-10-11-27(22)23/h4-15H,1-3H3.
What are the key properties of 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine?
8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine has a molecular weight of 351.45 g/mol, XLogP of 6.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-tert-butylnaphthalen-2-yl)imidazo[1,2-a][1,6]naphthyridine is sourced from PubChem (CID 164709359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).