About (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone
(2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone (PubChem CID 164709581) has the molecular formula C15H12FN3OS
and a molecular weight of 301.35 g/mol. Its IUPAC name is (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone.
Molecular Properties
| Compound Name | (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone |
| PubChem CID | 164709581 |
| Molecular Formula | C15H12FN3OS |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone |
| SMILES | Nc1nc2ccc(-c3cccs3)cn2c1C(=O)[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C15H12FN3OS/c16-10-6-9(10)14(20)13-15(17)18-12-4-3-8(7-19(12)13)11-2-1-5-21-11/h1-5,7,9-10H,6,17H2/t9-,10+/m1/s1 |
| InChIKey | LFEPESYTMOZGRB-ZJUUUORDSA-N |
| XLogP | 3.19 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
The IUPAC name of (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone (CID 164709581) is (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone.
What is the SMILES notation for (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
The canonical SMILES for (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone is Nc1nc2ccc(-c3cccs3)cn2c1C(=O)[C@@H]1C[C@@H]1F.
What is the InChIKey of (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
The InChIKey is LFEPESYTMOZGRB-ZJUUUORDSA-N. The full InChI is InChI=1S/C15H12FN3OS/c16-10-6-9(10)14(20)13-15(17)18-12-4-3-8(7-19(12)13)11-2-1-5-21-11/h1-5,7,9-10H,6,17H2/t9-,10+/m1/s1.
What are the key properties of (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone?
(2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone has a molecular weight of 301.35 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-6-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-[(1S,2S)-2-fluorocyclopropyl]methanone is sourced from PubChem (CID 164709581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).