About 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole
5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole (PubChem CID 164709946) has the molecular formula C16H16ClFN4S
and a molecular weight of 350.85 g/mol. Its IUPAC name is 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole.
Molecular Properties
| Compound Name | 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole |
| PubChem CID | 164709946 |
| Molecular Formula | C16H16ClFN4S |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole |
| SMILES | Cc1c(-c2nc(Cl)ncc2F)sc2c1nc(C)n2C1CCCC1 |
| InChI | InChI=1S/C16H16ClFN4S/c1-8-12-15(22(9(2)20-12)10-5-3-4-6-10)23-14(8)13-11(18)7-19-16(17)21-13/h7,10H,3-6H2,1-2H3 |
| InChIKey | WZUKEXSOEAVBTK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole?
The IUPAC name of 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole (CID 164709946) is 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole.
What is the SMILES notation for 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole?
The canonical SMILES for 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole is Cc1c(-c2nc(Cl)ncc2F)sc2c1nc(C)n2C1CCCC1.
What is the InChIKey of 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole?
The InChIKey is WZUKEXSOEAVBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClFN4S/c1-8-12-15(22(9(2)20-12)10-5-3-4-6-10)23-14(8)13-11(18)7-19-16(17)21-13/h7,10H,3-6H2,1-2H3.
What are the key properties of 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole?
5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole has a molecular weight of 350.85 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-5-fluoropyrimidin-4-yl)-3-cyclopentyl-2,6-dimethylthieno[2,3-d]imidazole is sourced from PubChem (CID 164709946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).