About 3,5,7-trihydroxyoctanal
3,5,7-trihydroxyoctanal (PubChem CID 164710591) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 3,5,7-trihydroxyoctanal.
Molecular Properties
| Compound Name | 3,5,7-trihydroxyoctanal |
| PubChem CID | 164710591 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3,5,7-trihydroxyoctanal |
| SMILES | CC(O)CC(O)CC(O)CC=O |
| InChI | InChI=1S/C8H16O4/c1-6(10)4-8(12)5-7(11)2-3-9/h3,6-8,10-12H,2,4-5H2,1H3 |
| InChIKey | RBSIMKHDETVEDU-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,5,7-trihydroxyoctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trihydroxyoctanal?
The IUPAC name of 3,5,7-trihydroxyoctanal (CID 164710591) is 3,5,7-trihydroxyoctanal.
What is the SMILES notation for 3,5,7-trihydroxyoctanal?
The canonical SMILES for 3,5,7-trihydroxyoctanal is CC(O)CC(O)CC(O)CC=O.
What is the InChIKey of 3,5,7-trihydroxyoctanal?
The InChIKey is RBSIMKHDETVEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-6(10)4-8(12)5-7(11)2-3-9/h3,6-8,10-12H,2,4-5H2,1H3.
What are the key properties of 3,5,7-trihydroxyoctanal?
3,5,7-trihydroxyoctanal has a molecular weight of 176.21 g/mol, XLogP of -0.54, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trihydroxyoctanal is sourced from PubChem (CID 164710591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).