C30H6F12N6 — CID 164711081
4-[cyano-[2-[cyano-(2,3,5,6-tetrafluoro-4-isocyanophenyl)methyl]-3-[(4-cyano-2,3,5,6-tetrafluorophenyl)-isocyanomethyl]cyclopropyl]methyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 164711081) has the molecular formula C30H6F12N6 and a molecular weight of 678.40 g/mol. Its IUPAC name is 4-[cyano-[2-[cyano-(2,3,5,6-tetrafluoro-4-isocyanophenyl)methyl]-3-[(4-cyano-2,3,5,6-tetrafluorophenyl)-isocyanomethyl]cyclopropyl]methyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[cyano-[2-[cyano-(2,3,5,6-tetrafluoro-4-isocyanophenyl)methyl]-3-[(4-cyano-2,3,5,6-tetrafluorophenyl)-isocyanomethyl]cyclopropyl]methyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 164711081 |
| Molecular Formula | C30H6F12N6 |
| Molecular Weight | 678.40 g/mol |
| Exact Mass | 678.05 |
| IUPAC Name | 4-[cyano-[2-[cyano-(2,3,5,6-tetrafluoro-4-isocyanophenyl)methyl]-3-[(4-cyano-2,3,5,6-tetrafluorophenyl)-isocyanomethyl]cyclopropyl]methyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | [C-]#[N+]c1c(F)c(F)c(C(C#N)C2C(C(C#N)c3c(F)c(F)c(C#N)c(F)c3F)C2C([N+]#[C-])c2c(F)c(F)c(C#N)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H6F12N6/c1-47-29(16-25(39)19(33)10(6-46)20(34)26(16)40)15-11(7(3-43)13-21(35)17(31)9(5-45)18(32)22(13)36)12(15)8(4-44)14-23(37)27(41)30(48-2)28(42)24(14)38/h7-8,11-12,15,29H |
| InChIKey | NNNWJFYRXIIELV-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 103.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.40 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|