About naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate
naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate (PubChem CID 164711572) has the molecular formula C22H14ClN3O2
and a molecular weight of 387.83 g/mol. Its IUPAC name is naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate.
Molecular Properties
| Compound Name | naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate |
| PubChem CID | 164711572 |
| Molecular Formula | C22H14ClN3O2 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate |
| SMILES | N#C/C(C(=O)OCc1ccc2ccccc2c1)=C1/Nc2ccccc2N=C1Cl |
| InChI | InChI=1S/C22H14ClN3O2/c23-21-20(25-18-7-3-4-8-19(18)26-21)17(12-24)22(27)28-13-14-9-10-15-5-1-2-6-16(15)11-14/h1-11,25H,13H2/b20-17- |
| InChIKey | WUXQYACMZJYDGY-JZJYNLBNSA-N |
| XLogP | 5.06 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
The IUPAC name of naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate (CID 164711572) is naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate.
What is the SMILES notation for naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
The canonical SMILES for naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate is N#C/C(C(=O)OCc1ccc2ccccc2c1)=C1/Nc2ccccc2N=C1Cl.
What is the InChIKey of naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
The InChIKey is WUXQYACMZJYDGY-JZJYNLBNSA-N. The full InChI is InChI=1S/C22H14ClN3O2/c23-21-20(25-18-7-3-4-8-19(18)26-21)17(12-24)22(27)28-13-14-9-10-15-5-1-2-6-16(15)11-14/h1-11,25H,13H2/b20-17-.
What are the key properties of naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate has a molecular weight of 387.83 g/mol, XLogP of 5.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylmethyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate is sourced from PubChem (CID 164711572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).