C47H31F3N2O5S — CID 164714096
[1-(2-aminophenyl)-8-(4-phenyl-N-(4-phenylphenyl)anilino)benzo[a]oxanthren-11-yl] trifluoromethanesulfonate (PubChem CID 164714096) has the molecular formula C47H31F3N2O5S and a molecular weight of 792.84 g/mol. Its IUPAC name is [1-(2-aminophenyl)-8-(4-phenyl-N-(4-phenylphenyl)anilino)benzo[a]oxanthren-11-yl] trifluoromethanesulfonate.
| Compound Name | [1-(2-aminophenyl)-8-(4-phenyl-N-(4-phenylphenyl)anilino)benzo[a]oxanthren-11-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164714096 |
| Molecular Formula | C47H31F3N2O5S |
| Molecular Weight | 792.84 g/mol |
| Exact Mass | 792.19 |
| IUPAC Name | [1-(2-aminophenyl)-8-(4-phenyl-N-(4-phenylphenyl)anilino)benzo[a]oxanthren-11-yl] trifluoromethanesulfonate |
| SMILES | Nc1ccccc1-c1cccc2ccc3c(c12)Oc1c(OS(=O)(=O)C(F)(F)F)ccc(N(c2ccc(-c4ccccc4)cc2)c2ccc(-c4ccccc4)cc2)c1O3 |
| InChI | InChI=1S/C47H31F3N2O5S/c48-47(49,50)58(53,54)57-42-29-27-40(44-46(42)56-45-41(55-44)28-22-34-14-9-16-38(43(34)45)37-15-7-8-17-39(37)51)52(35-23-18-32(19-24-35)30-10-3-1-4-11-30)36-25-20-33(21-26-36)31-12-5-2-6-13-31/h1-29H,51H2 |
| InChIKey | BYGYUIAEAWMFHE-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.84 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|