About 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one
2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one (PubChem CID 164714282) has the molecular formula C20H10F6N4OS
and a molecular weight of 468.38 g/mol. Its IUPAC name is 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one.
Molecular Properties
| Compound Name | 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one |
| PubChem CID | 164714282 |
| Molecular Formula | C20H10F6N4OS |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2nc(-c3cccc(C(F)(F)F)c3)c(-c3cccc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C20H10F6N4OS/c21-19(22,23)11-5-1-3-9(7-11)13-14(10-4-2-6-12(8-10)20(24,25)26)28-16-15(27-13)17(31)30-18(32)29-16/h1-8H,(H2,28,29,30,31,32) |
| InChIKey | GCWVQCWRFSEVPX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one?
The IUPAC name of 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one (CID 164714282) is 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one.
What is the SMILES notation for 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one?
The canonical SMILES for 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one is O=c1[nH]c(=S)[nH]c2nc(-c3cccc(C(F)(F)F)c3)c(-c3cccc(C(F)(F)F)c3)nc12.
What is the InChIKey of 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one?
The InChIKey is GCWVQCWRFSEVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10F6N4OS/c21-19(22,23)11-5-1-3-9(7-11)13-14(10-4-2-6-12(8-10)20(24,25)26)28-16-15(27-13)17(31)30-18(32)29-16/h1-8H,(H2,28,29,30,31,32).
What are the key properties of 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one?
2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one has a molecular weight of 468.38 g/mol, XLogP of 5.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-6,7-bis[3-(trifluoromethyl)phenyl]-1H-pteridin-4-one is sourced from PubChem (CID 164714282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).