C63H41N3S — CID 164716410
2-(3,5-diphenylphenyl)-1-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-4-phenylthieno[2,3-c]quinoline (PubChem CID 164716410) has the molecular formula C63H41N3S and a molecular weight of 872.11 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-1-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-4-phenylthieno[2,3-c]quinoline.
| Compound Name | 2-(3,5-diphenylphenyl)-1-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-4-phenylthieno[2,3-c]quinoline |
|---|---|
| PubChem CID | 164716410 |
| Molecular Formula | C63H41N3S |
| Molecular Weight | 872.11 g/mol |
| Exact Mass | 871.30 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-1-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-4-phenylthieno[2,3-c]quinoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3sc4c(-c5ccccc5)nc5ccccc5c4c3-c3ccc(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C63H41N3S/c1-6-18-42(19-7-1)51-38-52(43-20-8-2-9-21-43)40-53(39-51)61-58(59-54-28-16-17-29-55(54)64-60(62(59)67-61)49-24-12-4-13-25-49)48-36-32-45(33-37-48)44-30-34-47(35-31-44)57-41-56(46-22-10-3-11-23-46)65-63(66-57)50-26-14-5-15-27-50/h1-41H |
| InChIKey | TWZCUQJTAFBIDV-UHFFFAOYSA-N |
| XLogP | 17.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.11 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |