C10H12BrIN4O — CID 164718543
(3-bromo-1-ethylpyrazol-4-yl)-(3-iodo-1-methylpyrazol-4-yl)methanol (PubChem CID 164718543) has the molecular formula C10H12BrIN4O and a molecular weight of 411.04 g/mol. Its IUPAC name is (3-bromo-1-ethylpyrazol-4-yl)-(3-iodo-1-methylpyrazol-4-yl)methanol.
| Compound Name | (3-bromo-1-ethylpyrazol-4-yl)-(3-iodo-1-methylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 164718543 |
| Molecular Formula | C10H12BrIN4O |
| Molecular Weight | 411.04 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | (3-bromo-1-ethylpyrazol-4-yl)-(3-iodo-1-methylpyrazol-4-yl)methanol |
| SMILES | CCn1cc(C(O)c2cn(C)nc2I)c(Br)n1 |
| InChI | InChI=1S/C10H12BrIN4O/c1-3-16-5-6(9(11)13-16)8(17)7-4-15(2)14-10(7)12/h4-5,8,17H,3H2,1-2H3 |
| InChIKey | BQMNGNDGBCYETM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.04 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|