About 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole
3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole (PubChem CID 164718694) has the molecular formula C10H12IN3O
and a molecular weight of 317.13 g/mol. Its IUPAC name is 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole |
| PubChem CID | 164718694 |
| Molecular Formula | C10H12IN3O |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole |
| SMILES | CCc1cc(Cc2cn(C)nc2I)on1 |
| InChI | InChI=1S/C10H12IN3O/c1-3-8-5-9(15-13-8)4-7-6-14(2)12-10(7)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | BJIJSEMBNUMUOP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole?
The IUPAC name of 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole (CID 164718694) is 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole.
What is the SMILES notation for 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole?
The canonical SMILES for 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole is CCc1cc(Cc2cn(C)nc2I)on1.
What is the InChIKey of 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole?
The InChIKey is BJIJSEMBNUMUOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12IN3O/c1-3-8-5-9(15-13-8)4-7-6-14(2)12-10(7)11/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole?
3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole has a molecular weight of 317.13 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-[(3-iodo-1-methylpyrazol-4-yl)methyl]-1,2-oxazole is sourced from PubChem (CID 164718694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).