About 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile
5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile (PubChem CID 164718767) has the molecular formula C17H12FN5O3
and a molecular weight of 353.31 g/mol. Its IUPAC name is 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile |
| PubChem CID | 164718767 |
| Molecular Formula | C17H12FN5O3 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile |
| SMILES | N#Cc1cc(C(=O)c2ccnn2-c2ccc(F)cc2C2OCCO2)[nH]n1 |
| InChI | InChI=1S/C17H12FN5O3/c18-10-1-2-14(12(7-10)17-25-5-6-26-17)23-15(3-4-20-23)16(24)13-8-11(9-19)21-22-13/h1-4,7-8,17H,5-6H2,(H,21,22) |
| InChIKey | UKGCRLLBZDTJRN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile?
The IUPAC name of 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile (CID 164718767) is 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile.
What is the SMILES notation for 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile?
The canonical SMILES for 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile is N#Cc1cc(C(=O)c2ccnn2-c2ccc(F)cc2C2OCCO2)[nH]n1.
What is the InChIKey of 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile?
The InChIKey is UKGCRLLBZDTJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FN5O3/c18-10-1-2-14(12(7-10)17-25-5-6-26-17)23-15(3-4-20-23)16(24)13-8-11(9-19)21-22-13/h1-4,7-8,17H,5-6H2,(H,21,22).
What are the key properties of 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile?
5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile has a molecular weight of 353.31 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[2-(1,3-dioxolan-2-yl)-4-fluorophenyl]pyrazole-3-carbonyl]-1H-pyrazole-3-carbonitrile is sourced from PubChem (CID 164718767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).